C26H25ClN4O6 — CID 3933311
N-(3-chloro-4-methylphenyl)-N'-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]butanediamide (PubChem CID 3933311) has the molecular formula C26H25ClN4O6 and a molecular weight of 524.96 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3933311 |
| Molecular Formula | C26H25ClN4O6 |
| Molecular Weight | 524.96 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]butanediamide |
| SMILES | COc1cc(C=NNC(=O)CCC(=O)Nc2ccc(C)c(Cl)c2)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H25ClN4O6/c1-17-8-9-20(13-21(17)27)29-25(32)10-11-26(33)30-28-15-19-12-23(36-2)24(14-22(19)31(34)35)37-16-18-6-4-3-5-7-18/h3-9,12-15H,10-11,16H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | ZVIZVHKHXRLRNT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|