C31H36N4O7 — CID 126026562
(2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methylpentanamide (PubChem CID 126026562) has the molecular formula C31H36N4O7 and a molecular weight of 576.65 g/mol. Its IUPAC name is (2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methylpentanamide.
| Compound Name | (2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126026562 |
| Molecular Formula | C31H36N4O7 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | (2R)-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-N-[(Z)-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylideneamino]-4-methylpentanamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H](CC(C)C)NC(=O)COc2c(C)cccc2C)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H36N4O7/c1-20(2)14-25(33-29(36)19-42-30-21(3)10-9-11-22(30)4)31(37)34-32-17-24-15-27(40-5)28(16-26(24)35(38)39)41-18-23-12-7-6-8-13-23/h6-13,15-17,20,25H,14,18-19H2,1-5H3,(H,33,36)(H,34,37)/b32-17-/t25-/m1/s1 |
| InChIKey | YKUYYJHVLQUOCE-ZKSZTDLPSA-N |
| XLogP | 4.86 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|