C25H33N3O5 — CID 126017278
(2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide (PubChem CID 126017278) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is (2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126017278 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide |
| SMILES | COc1ccc(OC)c(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)COc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C25H33N3O5/c1-16(2)12-21(27-23(29)15-33-24-17(3)8-7-9-18(24)4)25(30)28-26-14-19-13-20(31-5)10-11-22(19)32-6/h7-11,13-14,16,21H,12,15H2,1-6H3,(H,27,29)(H,28,30)/b26-14-/t21-/m0/s1 |
| InChIKey | DGNXXVOLNBDURB-IDEIYSCTSA-N |
| XLogP | 3.38 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|