C25H32BrN3O5 — CID 126024842
(2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide (PubChem CID 126024842) has the molecular formula C25H32BrN3O5 and a molecular weight of 534.45 g/mol. Its IUPAC name is (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 126024842 |
| Molecular Formula | C25H32BrN3O5 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | (2S)-N-[(Z)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-[[2-(2,6-dimethylphenoxy)acetyl]amino]-4-methylpentanamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)[C@H](CC(C)C)NC(=O)COc2c(C)cccc2C)cc1Br |
| InChI | InChI=1S/C25H32BrN3O5/c1-15(2)10-20(28-23(30)14-34-24-16(3)8-7-9-17(24)4)25(31)29-27-13-18-11-19(26)22(33-6)12-21(18)32-5/h7-9,11-13,15,20H,10,14H2,1-6H3,(H,28,30)(H,29,31)/b27-13-/t20-/m0/s1 |
| InChIKey | UCYNCZOZNWGIEI-PLNVPOSRSA-N |
| XLogP | 4.14 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|