C19H22BrN3O3 — CID 75539036
N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(3-methylanilino)propanamide (PubChem CID 75539036) has the molecular formula C19H22BrN3O3 and a molecular weight of 420.31 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(3-methylanilino)propanamide.
| Compound Name | N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(3-methylanilino)propanamide |
|---|---|
| PubChem CID | 75539036 |
| Molecular Formula | C19H22BrN3O3 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(3-methylanilino)propanamide |
| SMILES | COc1cc(OC)c(/C=N/NC(=O)C(C)Nc2cccc(C)c2)cc1Br |
| InChI | InChI=1S/C19H22BrN3O3/c1-12-6-5-7-15(8-12)22-13(2)19(24)23-21-11-14-9-16(20)18(26-4)10-17(14)25-3/h5-11,13,22H,1-4H3,(H,23,24)/b21-11+ |
| InChIKey | XVZPKCYTGFDBJJ-SRZZPIQSSA-N |
| XLogP | 3.73 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|