C20H25N3O4 — CID 75539050
2-(3-methylanilino)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 75539050) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(3-methylanilino)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 2-(3-methylanilino)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 75539050 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-(3-methylanilino)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(/C=N/NC(=O)C(C)Nc2cccc(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25N3O4/c1-13-7-6-8-16(9-13)22-14(2)20(24)23-21-12-15-10-17(25-3)19(27-5)18(11-15)26-4/h6-12,14,22H,1-5H3,(H,23,24)/b21-12+ |
| InChIKey | QGTYMTGQFWRASM-CIAFOILYSA-N |
| XLogP | 2.97 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|