C17H18ClN3O2 — CID 40571584
(2S)-2-(3-chloroanilino)-N-[(Z)-(2-methoxyphenyl)methylideneamino]propanamide (PubChem CID 40571584) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is (2S)-2-(3-chloroanilino)-N-[(Z)-(2-methoxyphenyl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(3-chloroanilino)-N-[(Z)-(2-methoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 40571584 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2S)-2-(3-chloroanilino)-N-[(Z)-(2-methoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1ccccc1/C=N\NC(=O)[C@H](C)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-12(20-15-8-5-7-14(18)10-15)17(22)21-19-11-13-6-3-4-9-16(13)23-2/h3-12,20H,1-2H3,(H,21,22)/b19-11-/t12-/m0/s1 |
| InChIKey | QWLGEXQAPBCLSH-XHEYCZLTSA-N |
| XLogP | 3.30 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|