C15H18ClN5O — CID 722446
(2S)-2-(3-chloroanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide (PubChem CID 722446) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is (2S)-2-(3-chloroanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(3-chloroanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 722446 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2S)-2-(3-chloroanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide |
| SMILES | Cc1nn(C)cc1C=NNC(=O)[C@H](C)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClN5O/c1-10-12(9-21(3)20-10)8-17-19-15(22)11(2)18-14-6-4-5-13(16)7-14/h4-9,11,18H,1-3H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | HVUQNVVYUXCWPG-NSHDSACASA-N |
| XLogP | 2.33 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|