C15H18BrN5O — CID 3901836
2-(4-bromoanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide (PubChem CID 3901836) has the molecular formula C15H18BrN5O and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide.
| Compound Name | 2-(4-bromoanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 3901836 |
| Molecular Formula | C15H18BrN5O |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]propanamide |
| SMILES | Cc1nn(C)cc1C=NNC(=O)C(C)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrN5O/c1-10-12(9-21(3)20-10)8-17-19-15(22)11(2)18-14-6-4-13(16)5-7-14/h4-9,11,18H,1-3H3,(H,19,22) |
| InChIKey | GFRYAYBAYBGIEM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|