C14H14N5O2S- — CID 6927443
3-[[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]carbamothioylamino]benzoate (PubChem CID 6927443) has the molecular formula C14H14N5O2S- and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-[[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]carbamothioylamino]benzoate.
| Compound Name | 3-[[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 6927443 |
| Molecular Formula | C14H14N5O2S- |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]carbamothioylamino]benzoate |
| SMILES | Cc1nn(C)cc1/C=N\NC(=S)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C14H15N5O2S/c1-9-11(8-19(2)18-9)7-15-17-14(22)16-12-5-3-4-10(6-12)13(20)21/h3-8H,1-2H3,(H,20,21)(H2,16,17,22)/p-1/b15-7- |
| InChIKey | HXUBEZURCCDITI-CHHVJCJISA-M |
| XLogP | 0.41 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|