C13H14N4OS — CID 102801518
N-(3-carbamothioylphenyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 102801518) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(3-carbamothioylphenyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 102801518 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(3-carbamothioylphenyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C13H14N4OS/c1-8-11(7-17(2)16-8)13(18)15-10-5-3-4-9(6-10)12(14)19/h3-7H,1-2H3,(H2,14,19)(H,15,18) |
| InChIKey | OLWNDTHQEUIJNL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|