C22H20N4O4 — CID 29097609
3-N,4-N-bis(3-acetylphenyl)-1-methylpyrazole-3,4-dicarboxamide (PubChem CID 29097609) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-N,4-N-bis(3-acetylphenyl)-1-methylpyrazole-3,4-dicarboxamide.
| Compound Name | 3-N,4-N-bis(3-acetylphenyl)-1-methylpyrazole-3,4-dicarboxamide |
|---|---|
| PubChem CID | 29097609 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-N,4-N-bis(3-acetylphenyl)-1-methylpyrazole-3,4-dicarboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2cn(C)nc2C(=O)Nc2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C22H20N4O4/c1-13(27)15-6-4-8-17(10-15)23-21(29)19-12-26(3)25-20(19)22(30)24-18-9-5-7-16(11-18)14(2)28/h4-12H,1-3H3,(H,23,29)(H,24,30) |
| InChIKey | PYGDNJOUGWOCKA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |