C16H14N6O2 — CID 29097607
1-methyl-3-N,4-N-dipyridin-2-ylpyrazole-3,4-dicarboxamide (PubChem CID 29097607) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-methyl-3-N,4-N-dipyridin-2-ylpyrazole-3,4-dicarboxamide.
| Compound Name | 1-methyl-3-N,4-N-dipyridin-2-ylpyrazole-3,4-dicarboxamide |
|---|---|
| PubChem CID | 29097607 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-methyl-3-N,4-N-dipyridin-2-ylpyrazole-3,4-dicarboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccn2)c(C(=O)Nc2ccccn2)n1 |
| InChI | InChI=1S/C16H14N6O2/c1-22-10-11(15(23)19-12-6-2-4-8-17-12)14(21-22)16(24)20-13-7-3-5-9-18-13/h2-10H,1H3,(H,17,19,23)(H,18,20,24) |
| InChIKey | NBOGCYIGOPQZOL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |