C16H14N4O2 — CID 24538158
4-methoxy-1-phenyl-N-pyridin-2-ylpyrazole-3-carboxamide (PubChem CID 24538158) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-methoxy-1-phenyl-N-pyridin-2-ylpyrazole-3-carboxamide.
| Compound Name | 4-methoxy-1-phenyl-N-pyridin-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24538158 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 4-methoxy-1-phenyl-N-pyridin-2-ylpyrazole-3-carboxamide |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C16H14N4O2/c1-22-13-11-20(12-7-3-2-4-8-12)19-15(13)16(21)18-14-9-5-6-10-17-14/h2-11H,1H3,(H,17,18,21) |
| InChIKey | NJBFZXSNVSYFAI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |