C19H19N5O3 — CID 47034464
4-methoxy-N-[3-oxo-3-(pyridin-2-ylamino)propyl]-1-phenylpyrazole-3-carboxamide (PubChem CID 47034464) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-methoxy-N-[3-oxo-3-(pyridin-2-ylamino)propyl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-methoxy-N-[3-oxo-3-(pyridin-2-ylamino)propyl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47034464 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-methoxy-N-[3-oxo-3-(pyridin-2-ylamino)propyl]-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)NCCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C19H19N5O3/c1-27-15-13-24(14-7-3-2-4-8-14)23-18(15)19(26)21-12-10-17(25)22-16-9-5-6-11-20-16/h2-9,11,13H,10,12H2,1H3,(H,21,26)(H,20,22,25) |
| InChIKey | LFHYZZDTYBWJLO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |