C15H11ClN3O3S- — CID 135678789
2-[(E)-[(3-carboxyphenyl)carbamothioylhydrazinylidene]methyl]-4-chlorophenolate (PubChem CID 135678789) has the molecular formula C15H11ClN3O3S- and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-[(E)-[(3-carboxyphenyl)carbamothioylhydrazinylidene]methyl]-4-chlorophenolate.
| Compound Name | 2-[(E)-[(3-carboxyphenyl)carbamothioylhydrazinylidene]methyl]-4-chlorophenolate |
|---|---|
| PubChem CID | 135678789 |
| Molecular Formula | C15H11ClN3O3S- |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-[(E)-[(3-carboxyphenyl)carbamothioylhydrazinylidene]methyl]-4-chlorophenolate |
| SMILES | O=C(O)c1cccc(NC(=S)N/N=C/c2cc(Cl)ccc2[O-])c1 |
| InChI | InChI=1S/C15H12ClN3O3S/c16-11-4-5-13(20)10(6-11)8-17-19-15(23)18-12-3-1-2-9(7-12)14(21)22/h1-8,20H,(H,21,22)(H2,18,19,23)/p-1/b17-8+ |
| InChIKey | USYCRXALBNDUKJ-CAOOACKPSA-M |
| XLogP | 2.43 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|