C16H15N3O3S — CID 136601679
4-[[(2-hydroxy-3-methylphenyl)methylideneamino]carbamothioylamino]benzoic acid (PubChem CID 136601679) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-[[(2-hydroxy-3-methylphenyl)methylideneamino]carbamothioylamino]benzoic acid.
| Compound Name | 4-[[(2-hydroxy-3-methylphenyl)methylideneamino]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 136601679 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-[[(2-hydroxy-3-methylphenyl)methylideneamino]carbamothioylamino]benzoic acid |
| SMILES | Cc1cccc(C=NNC(=S)Nc2ccc(C(=O)O)cc2)c1O |
| InChI | InChI=1S/C16H15N3O3S/c1-10-3-2-4-12(14(10)20)9-17-19-16(23)18-13-7-5-11(6-8-13)15(21)22/h2-9,20H,1H3,(H,21,22)(H2,18,19,23) |
| InChIKey | UPYSQLCTQXVZNP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|