C22H20N2O3 — CID 135533066
2-hydroxy-N-[(E)-(2-hydroxy-3-methylphenyl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 135533066) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-(2-hydroxy-3-methylphenyl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(E)-(2-hydroxy-3-methylphenyl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 135533066 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-hydroxy-N-[(E)-(2-hydroxy-3-methylphenyl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | Cc1cccc(/C=N/NC(=O)C(O)(c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C22H20N2O3/c1-16-9-8-10-17(20(16)25)15-23-24-21(26)22(27,18-11-4-2-5-12-18)19-13-6-3-7-14-19/h2-15,25,27H,1H3,(H,24,26)/b23-15+ |
| InChIKey | BJLPKZWVCUWSPU-HZHRSRAPSA-N |
| XLogP | 3.09 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|