C22H17F3N2O2 — CID 3297687
2-hydroxy-2,2-diphenyl-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 3297687) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenyl-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-hydroxy-2,2-diphenyl-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3297687 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-hydroxy-2,2-diphenyl-N-[[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | O=C(NN=Cc1ccccc1C(F)(F)F)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17F3N2O2/c23-22(24,25)19-14-8-7-9-16(19)15-26-27-20(28)21(29,17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15,29H,(H,27,28) |
| InChIKey | CPHBDWJYOCEPPT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|