C21H16Br2N2O4 — CID 135781632
N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 135781632) has the molecular formula C21H16Br2N2O4 and a molecular weight of 520.18 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 135781632 |
| Molecular Formula | C21H16Br2N2O4 |
| Molecular Weight | 520.18 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1cc(Br)c(O)c(Br)c1O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16Br2N2O4/c22-16-11-13(18(26)17(23)19(16)27)12-24-25-20(28)21(29,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,26-27,29H,(H,25,28)/b24-12- |
| InChIKey | NCCRKXIBWCUQAY-MSXFZWOLSA-N |
| XLogP | 4.01 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|