C29H34N2O3 — CID 136794022
N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 136794022) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 136794022 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CC(C)(C)c1cc(/C=N\NC(=O)C(O)(c2ccccc2)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H34N2O3/c1-27(2,3)23-17-20(18-24(25(23)32)28(4,5)6)19-30-31-26(33)29(34,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-19,32,34H,1-6H3,(H,31,33)/b30-19- |
| InChIKey | SHDGDMRENDXAFW-FSGOGVSDSA-N |
| XLogP | 5.37 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|