C22H19I2N3O2 — CID 3556040
N-[[3,5-diiodo-4-(methylamino)phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 3556040) has the molecular formula C22H19I2N3O2 and a molecular weight of 611.22 g/mol. Its IUPAC name is N-[[3,5-diiodo-4-(methylamino)phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[[3,5-diiodo-4-(methylamino)phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 3556040 |
| Molecular Formula | C22H19I2N3O2 |
| Molecular Weight | 611.22 g/mol |
| Exact Mass | 610.96 |
| IUPAC Name | N-[[3,5-diiodo-4-(methylamino)phenyl]methylideneamino]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CNc1c(I)cc(C=NNC(=O)C(O)(c2ccccc2)c2ccccc2)cc1I |
| InChI | InChI=1S/C22H19I2N3O2/c1-25-20-18(23)12-15(13-19(20)24)14-26-27-21(28)22(29,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,25,29H,1H3,(H,27,28) |
| InChIKey | VRMRNGDKMTZIRU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|