C21H16N3O5- — CID 7032585
4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-nitrophenolate (PubChem CID 7032585) has the molecular formula C21H16N3O5- and a molecular weight of 390.38 g/mol. Its IUPAC name is 4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-nitrophenolate.
| Compound Name | 4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7032585 |
| Molecular Formula | C21H16N3O5- |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]-2-nitrophenolate |
| SMILES | O=C(N/N=C\c1ccc([O-])c([N+](=O)[O-])c1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17N3O5/c25-19-12-11-15(13-18(19)24(28)29)14-22-23-20(26)21(27,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,25,27H,(H,23,26)/p-1/b22-14- |
| InChIKey | FALGCSABVTVDDN-HMAPJEAMSA-M |
| XLogP | 2.05 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|