C23H19N3O4 — CID 5338017
2-hydroxy-N-[(E)-[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-2,2-diphenylacetamide (PubChem CID 5338017) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(E)-[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5338017 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-hydroxy-N-[(E)-[(E)-3-(4-nitrophenyl)prop-2-enylidene]amino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C/C=C/c1ccc([N+](=O)[O-])cc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O4/c27-22(25-24-17-7-8-18-13-15-21(16-14-18)26(29)30)23(28,19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-17,28H,(H,25,27)/b8-7+,24-17+ |
| InChIKey | DTAHUHYRLMXRBK-IKWXZYGUSA-N |
| XLogP | 3.65 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|