C25H19N3O4 — CID 139971966
N-[(1E,3E)-1-cyano-4-(4-nitrophenyl)buta-1,3-dienyl]-2-hydroxy-2,2-diphenylacetamide (PubChem CID 139971966) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[(1E,3E)-1-cyano-4-(4-nitrophenyl)buta-1,3-dienyl]-2-hydroxy-2,2-diphenylacetamide.
| Compound Name | N-[(1E,3E)-1-cyano-4-(4-nitrophenyl)buta-1,3-dienyl]-2-hydroxy-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 139971966 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[(1E,3E)-1-cyano-4-(4-nitrophenyl)buta-1,3-dienyl]-2-hydroxy-2,2-diphenylacetamide |
| SMILES | N#C/C(=C\C=C\c1ccc([N+](=O)[O-])cc1)NC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H19N3O4/c26-18-22(13-7-8-19-14-16-23(17-15-19)28(31)32)27-24(29)25(30,20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-17,30H,(H,27,29)/b8-7+,22-13+ |
| InChIKey | PGMCJYMSLSIXJG-CASIMXJUSA-N |
| XLogP | 4.07 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|