C22H27NO3Si — CID 102342625
tert-butyl-dimethyl-[(1Z,3Z)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]silane (PubChem CID 102342625) has the molecular formula C22H27NO3Si and a molecular weight of 381.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1Z,3Z)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1Z,3Z)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]silane |
|---|---|
| PubChem CID | 102342625 |
| Molecular Formula | C22H27NO3Si |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1Z,3Z)-4-(4-nitrophenyl)-1-phenylbuta-1,3-dienoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O/C(=C\C=C/c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3Si/c1-22(2,3)27(4,5)26-21(19-11-7-6-8-12-19)13-9-10-18-14-16-20(17-15-18)23(24)25/h6-17H,1-5H3/b10-9-,21-13- |
| InChIKey | MSUYJISELLCNMW-MWCNFEMPSA-N |
| XLogP | 6.67 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|