C22H22N2O5 — CID 7244704
2-methylpropyl (2E,4E)-2-benzamido-5-(4-nitrophenyl)penta-2,4-dienoate (PubChem CID 7244704) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-methylpropyl (2E,4E)-2-benzamido-5-(4-nitrophenyl)penta-2,4-dienoate.
| Compound Name | 2-methylpropyl (2E,4E)-2-benzamido-5-(4-nitrophenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 7244704 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-methylpropyl (2E,4E)-2-benzamido-5-(4-nitrophenyl)penta-2,4-dienoate |
| SMILES | CC(C)COC(=O)/C(=C\C=C\c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c1-16(2)15-29-22(26)20(23-21(25)18-8-4-3-5-9-18)10-6-7-17-11-13-19(14-12-17)24(27)28/h3-14,16H,15H2,1-2H3,(H,23,25)/b7-6+,20-10+ |
| InChIKey | HQSVBHGCBWZTGI-VCPLEAFOSA-N |
| XLogP | 4.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|