C19H18N2O6 — CID 18552542
2-hydroxypropyl (Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 18552542) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-hydroxypropyl (Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | 2-hydroxypropyl (Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18552542 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-hydroxypropyl (Z)-2-benzamido-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | CC(O)COC(=O)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O6/c1-13(22)12-27-19(24)17(20-18(23)15-5-3-2-4-6-15)11-14-7-9-16(10-8-14)21(25)26/h2-11,13,22H,12H2,1H3,(H,20,23)/b17-11- |
| InChIKey | DWPAFIGAHDHNPF-BOPFTXTBSA-N |
| XLogP | 2.29 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|