C21H22N2O6 — CID 2909872
methyl 2-[(4-butoxybenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 2909872) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 2-[(4-butoxybenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | methyl 2-[(4-butoxybenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2909872 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl 2-[(4-butoxybenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | CCCCOc1ccc(C(=O)NC(=Cc2ccc([N+](=O)[O-])cc2)C(=O)OC)cc1 |
| InChI | InChI=1S/C21H22N2O6/c1-3-4-13-29-18-11-7-16(8-12-18)20(24)22-19(21(25)28-2)14-15-5-9-17(10-6-15)23(26)27/h5-12,14H,3-4,13H2,1-2H3,(H,22,24) |
| InChIKey | OWPMXPKYTMWAJC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|