C28H30N4O5 — CID 46496987
4-butoxy-N-[(E)-1-[4-(dimethylamino)phenyl]-3-(3-nitroanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46496987) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is 4-butoxy-N-[(E)-1-[4-(dimethylamino)phenyl]-3-(3-nitroanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[(E)-1-[4-(dimethylamino)phenyl]-3-(3-nitroanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46496987 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 4-butoxy-N-[(E)-1-[4-(dimethylamino)phenyl]-3-(3-nitroanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N/C(=C/c2ccc(N(C)C)cc2)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H30N4O5/c1-4-5-17-37-25-15-11-21(12-16-25)27(33)30-26(18-20-9-13-23(14-10-20)31(2)3)28(34)29-22-7-6-8-24(19-22)32(35)36/h6-16,18-19H,4-5,17H2,1-3H3,(H,29,34)(H,30,33)/b26-18+ |
| InChIKey | YVWSMFWVUGLLRQ-NLRVBDNBSA-N |
| XLogP | 5.25 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|