C30H32BrN3O5 — CID 46496797
2-bromo-N-[(Z)-1-(3-nitrophenyl)-3-(4-octoxyanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46496797) has the molecular formula C30H32BrN3O5 and a molecular weight of 594.51 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-1-(3-nitrophenyl)-3-(4-octoxyanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(Z)-1-(3-nitrophenyl)-3-(4-octoxyanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46496797 |
| Molecular Formula | C30H32BrN3O5 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 2-bromo-N-[(Z)-1-(3-nitrophenyl)-3-(4-octoxyanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCCCCCOc1ccc(NC(=O)/C(=C/c2cccc([N+](=O)[O-])c2)NC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C30H32BrN3O5/c1-2-3-4-5-6-9-19-39-25-17-15-23(16-18-25)32-30(36)28(21-22-11-10-12-24(20-22)34(37)38)33-29(35)26-13-7-8-14-27(26)31/h7-8,10-18,20-21H,2-6,9,19H2,1H3,(H,32,36)(H,33,35)/b28-21- |
| InChIKey | PBGKUXNTJOWBAN-HFTWOUSFSA-N |
| XLogP | 7.51 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|