C22H15Br2N3O4 — CID 45105629
2-bromo-N-[(Z)-3-(4-bromoanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 45105629) has the molecular formula C22H15Br2N3O4 and a molecular weight of 545.19 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-3-(4-bromoanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(Z)-3-(4-bromoanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 45105629 |
| Molecular Formula | C22H15Br2N3O4 |
| Molecular Weight | 545.19 g/mol |
| Exact Mass | 542.94 |
| IUPAC Name | 2-bromo-N-[(Z)-3-(4-bromoanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C22H15Br2N3O4/c23-15-8-10-16(11-9-15)25-22(29)20(13-14-4-3-5-17(12-14)27(30)31)26-21(28)18-6-1-2-7-19(18)24/h1-13H,(H,25,29)(H,26,28)/b20-13- |
| InChIKey | GLTIFBBWQRNEJC-MOSHPQCFSA-N |
| XLogP | 5.53 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.19 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|