C24H19Br2N3O5 — CID 46497420
5-bromo-N-[(Z)-3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 46497420) has the molecular formula C24H19Br2N3O5 and a molecular weight of 589.24 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46497420 |
| Molecular Formula | C24H19Br2N3O5 |
| Molecular Weight | 589.24 g/mol |
| Exact Mass | 586.97 |
| IUPAC Name | 5-bromo-N-[(Z)-3-(4-bromo-3-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)N/C(=C\c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C24H19Br2N3O5/c1-14-10-17(7-8-20(14)26)27-24(31)21(12-15-4-3-5-18(11-15)29(32)33)28-23(30)19-13-16(25)6-9-22(19)34-2/h3-13H,1-2H3,(H,27,31)(H,28,30)/b21-12- |
| InChIKey | LQKBTYLTSJJDQS-MTJSOVHGSA-N |
| XLogP | 5.85 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.24 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|