C25H22BrN3O5 — CID 46497386
5-bromo-N-[(Z)-3-(3,4-dimethylanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide (PubChem CID 46497386) has the molecular formula C25H22BrN3O5 and a molecular weight of 524.37 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-3-(3,4-dimethylanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[(Z)-3-(3,4-dimethylanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46497386 |
| Molecular Formula | C25H22BrN3O5 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 5-bromo-N-[(Z)-3-(3,4-dimethylanilino)-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)N/C(=C\c1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C25H22BrN3O5/c1-15-4-8-19(12-16(15)2)27-25(31)22(13-17-5-9-20(10-6-17)29(32)33)28-24(30)21-14-18(26)7-11-23(21)34-3/h4-14H,1-3H3,(H,27,31)(H,28,30)/b22-13- |
| InChIKey | ALMUWVLPRPHQBX-XKZIYDEJSA-N |
| XLogP | 5.39 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|