C22H15FN4O6 — CID 46497178
2-fluoro-N-[(Z)-3-(4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46497178) has the molecular formula C22H15FN4O6 and a molecular weight of 450.38 g/mol. Its IUPAC name is 2-fluoro-N-[(Z)-3-(4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[(Z)-3-(4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46497178 |
| Molecular Formula | C22H15FN4O6 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-fluoro-N-[(Z)-3-(4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C22H15FN4O6/c23-19-7-2-1-6-18(19)21(28)25-20(13-14-4-3-5-17(12-14)27(32)33)22(29)24-15-8-10-16(11-9-15)26(30)31/h1-13H,(H,24,29)(H,25,28)/b20-13- |
| InChIKey | AMXOFJGWELYZMM-MOSHPQCFSA-N |
| XLogP | 4.05 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|