C23H16Cl2FN3O4 — CID 46497223
2-chloro-N-[(Z)-3-(3-chloro-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide (PubChem CID 46497223) has the molecular formula C23H16Cl2FN3O4 and a molecular weight of 488.30 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-3-(3-chloro-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[(Z)-3-(3-chloro-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46497223 |
| Molecular Formula | C23H16Cl2FN3O4 |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 2-chloro-N-[(Z)-3-(3-chloro-4-methylanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide |
| SMILES | Cc1ccc(NC(=O)/C(=C/c2cccc([N+](=O)[O-])c2)NC(=O)c2ccc(F)cc2Cl)cc1Cl |
| InChI | InChI=1S/C23H16Cl2FN3O4/c1-13-5-7-16(12-19(13)24)27-23(31)21(10-14-3-2-4-17(9-14)29(32)33)28-22(30)18-8-6-15(26)11-20(18)25/h2-12H,1H3,(H,27,31)(H,28,30)/b21-10- |
| InChIKey | RJKRMUSCRFEOGL-FBHDLOMBSA-N |
| XLogP | 5.76 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|