C22H13Cl3FN3O4 — CID 46497221
2-chloro-N-[(Z)-3-(2,4-dichloroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide (PubChem CID 46497221) has the molecular formula C22H13Cl3FN3O4 and a molecular weight of 508.72 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-3-(2,4-dichloroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[(Z)-3-(2,4-dichloroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 46497221 |
| Molecular Formula | C22H13Cl3FN3O4 |
| Molecular Weight | 508.72 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | 2-chloro-N-[(Z)-3-(2,4-dichloroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H13Cl3FN3O4/c23-13-4-7-19(18(25)10-13)27-22(31)20(9-12-2-1-3-15(8-12)29(32)33)28-21(30)16-6-5-14(26)11-17(16)24/h1-11H,(H,27,31)(H,28,30)/b20-9- |
| InChIKey | OMWJAFBJATYBHW-UKWGHVSLSA-N |
| XLogP | 6.10 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|