C25H22ClN3O7 — CID 46496985
2-chloro-N-[(E)-3-(3,4-dimethoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 46496985) has the molecular formula C25H22ClN3O7 and a molecular weight of 511.92 g/mol. Its IUPAC name is 2-chloro-N-[(E)-3-(3,4-dimethoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | 2-chloro-N-[(E)-3-(3,4-dimethoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46496985 |
| Molecular Formula | C25H22ClN3O7 |
| Molecular Weight | 511.92 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 2-chloro-N-[(E)-3-(3,4-dimethoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C/c2cccc([N+](=O)[O-])c2)C(=O)Nc2ccc(OC)c(OC)c2)c(Cl)c1 |
| InChI | InChI=1S/C25H22ClN3O7/c1-34-18-8-9-19(20(26)14-18)24(30)28-21(12-15-5-4-6-17(11-15)29(32)33)25(31)27-16-7-10-22(35-2)23(13-16)36-3/h4-14H,1-3H3,(H,27,31)(H,28,30)/b21-12+ |
| InChIKey | SDYLXDIBEKTCRC-CIAFOILYSA-N |
| XLogP | 4.68 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|