C24H19ClN4O8 — CID 46497332
5-chloro-2-methoxy-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 46497332) has the molecular formula C24H19ClN4O8 and a molecular weight of 526.89 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 46497332 |
| Molecular Formula | C24H19ClN4O8 |
| Molecular Weight | 526.89 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(Z)-3-(2-methoxy-4-nitroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C24H19ClN4O8/c1-36-21-9-6-15(25)12-18(21)23(30)27-20(11-14-4-3-5-16(10-14)28(32)33)24(31)26-19-8-7-17(29(34)35)13-22(19)37-2/h3-13H,1-2H3,(H,26,31)(H,27,30)/b20-11- |
| InChIKey | DZMARQAPCLMMOD-JAIQZWGSSA-N |
| XLogP | 4.58 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|