C24H19BrClN3O6 — CID 46497435
3-bromo-N-[(Z)-3-(5-chloro-2-methoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 46497435) has the molecular formula C24H19BrClN3O6 and a molecular weight of 560.79 g/mol. Its IUPAC name is 3-bromo-N-[(Z)-3-(5-chloro-2-methoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[(Z)-3-(5-chloro-2-methoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46497435 |
| Molecular Formula | C24H19BrClN3O6 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 3-bromo-N-[(Z)-3-(5-chloro-2-methoxyanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C\c2cccc([N+](=O)[O-])c2)C(=O)Nc2cc(Cl)ccc2OC)cc1Br |
| InChI | InChI=1S/C24H19BrClN3O6/c1-34-21-8-6-15(12-18(21)25)23(30)28-20(11-14-4-3-5-17(10-14)29(32)33)24(31)27-19-13-16(26)7-9-22(19)35-2/h3-13H,1-2H3,(H,27,31)(H,28,30)/b20-11- |
| InChIKey | YKQDLGAJNAJMAO-JAIQZWGSSA-N |
| XLogP | 5.44 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|