C22H13ClF2N4O6 — CID 46497297
2-chloro-N-[(Z)-3-(2,4-difluoroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-5-nitrobenzamide (PubChem CID 46497297) has the molecular formula C22H13ClF2N4O6 and a molecular weight of 502.82 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-3-(2,4-difluoroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(Z)-3-(2,4-difluoroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 46497297 |
| Molecular Formula | C22H13ClF2N4O6 |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2-chloro-N-[(Z)-3-(2,4-difluoroanilino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(F)cc1F)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C22H13ClF2N4O6/c23-17-6-5-15(29(34)35)11-16(17)21(30)27-20(9-12-2-1-3-14(8-12)28(32)33)22(31)26-19-7-4-13(24)10-18(19)25/h1-11H,(H,26,31)(H,27,30)/b20-9- |
| InChIKey | BLWNHNGQMZUTEA-UKWGHVSLSA-N |
| XLogP | 4.84 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|