C27H21N3O4 — CID 35596904
2-methyl-N-[(E)-3-(naphthalen-2-ylamino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 35596904) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-methyl-N-[(E)-3-(naphthalen-2-ylamino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-methyl-N-[(E)-3-(naphthalen-2-ylamino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 35596904 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-methyl-N-[(E)-3-(naphthalen-2-ylamino)-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)N/C(=C/c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H21N3O4/c1-18-7-2-5-12-24(18)26(31)29-25(16-19-8-6-11-23(15-19)30(33)34)27(32)28-22-14-13-20-9-3-4-10-21(20)17-22/h2-17H,1H3,(H,28,32)(H,29,31)/b25-16+ |
| InChIKey | FMFJIVYMNHEABU-PCLIKHOPSA-N |
| XLogP | 5.47 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|