C19H16BrN3O6 — CID 2908310
2-[[2-[(2-bromobenzoyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 2908310) has the molecular formula C19H16BrN3O6 and a molecular weight of 462.26 g/mol. Its IUPAC name is 2-[[2-[(2-bromobenzoyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(2-bromobenzoyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 2908310 |
| Molecular Formula | C19H16BrN3O6 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 2-[[2-[(2-bromobenzoyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(=Cc1cccc([N+](=O)[O-])c1)NC(=O)c1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C19H16BrN3O6/c1-11(19(26)27)21-18(25)16(10-12-5-4-6-13(9-12)23(28)29)22-17(24)14-7-2-3-8-15(14)20/h2-11H,1H3,(H,21,25)(H,22,24)(H,26,27) |
| InChIKey | DTXXLXBSBIPEQK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|