C19H19N3O4 — CID 4926221
2-acetamido-3-(3-nitrophenyl)-N-(1-phenylethyl)prop-2-enamide (PubChem CID 4926221) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-acetamido-3-(3-nitrophenyl)-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | 2-acetamido-3-(3-nitrophenyl)-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 4926221 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-acetamido-3-(3-nitrophenyl)-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(=O)NC(=Cc1cccc([N+](=O)[O-])c1)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O4/c1-13(16-8-4-3-5-9-16)20-19(24)18(21-14(2)23)12-15-7-6-10-17(11-15)22(25)26/h3-13H,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | XIQAOBOQZIDLOG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|