C21H20BrN3O6S — CID 98126242
(2S)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 98126242) has the molecular formula C21H20BrN3O6S and a molecular weight of 522.38 g/mol. Its IUPAC name is (2S)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 98126242 |
| Molecular Formula | C21H20BrN3O6S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | (2S)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C21H20BrN3O6S/c1-32-11-10-17(21(28)29)23-20(27)18(12-13-6-8-14(9-7-13)25(30)31)24-19(26)15-4-2-3-5-16(15)22/h2-9,12,17H,10-11H2,1H3,(H,23,27)(H,24,26)(H,28,29)/b18-12-/t17-/m0/s1 |
| InChIKey | LMIZDFHRCURYPM-KMTKGMGQSA-N |
| XLogP | 3.45 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|