C19H16BrClN2O4 — CID 2257706
(2R)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 2257706) has the molecular formula C19H16BrClN2O4 and a molecular weight of 451.70 g/mol. Its IUPAC name is (2R)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 2257706 |
| Molecular Formula | C19H16BrClN2O4 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | (2R)-2-[[(Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C19H16BrClN2O4/c1-11(19(26)27)22-18(25)16(10-12-6-8-13(21)9-7-12)23-17(24)14-4-2-3-5-15(14)20/h2-11H,1H3,(H,22,25)(H,23,24)(H,26,27)/b16-10-/t11-/m1/s1 |
| InChIKey | HTBBJVJNUMGPFY-FFCYNSPCSA-N |
| XLogP | 3.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|