C21H21BrClNO3 — CID 2248024
3-methylbutyl (Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 2248024) has the molecular formula C21H21BrClNO3 and a molecular weight of 450.76 g/mol. Its IUPAC name is 3-methylbutyl (Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | 3-methylbutyl (Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2248024 |
| Molecular Formula | C21H21BrClNO3 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 3-methylbutyl (Z)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CC(C)CCOC(=O)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C21H21BrClNO3/c1-14(2)11-12-27-21(26)19(13-15-7-9-16(23)10-8-15)24-20(25)17-5-3-4-6-18(17)22/h3-10,13-14H,11-12H2,1-2H3,(H,24,25)/b19-13- |
| InChIKey | HKQUCBBBYICEDO-UYRXBGFRSA-N |
| XLogP | 5.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|