C21H16BrClN2O3 — CID 1327985
2-bromo-N-[1-(4-chlorophenyl)-3-(furan-2-ylmethylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 1327985) has the molecular formula C21H16BrClN2O3 and a molecular weight of 459.73 g/mol. Its IUPAC name is 2-bromo-N-[1-(4-chlorophenyl)-3-(furan-2-ylmethylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-bromo-N-[1-(4-chlorophenyl)-3-(furan-2-ylmethylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 1327985 |
| Molecular Formula | C21H16BrClN2O3 |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 2-bromo-N-[1-(4-chlorophenyl)-3-(furan-2-ylmethylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1ccco1)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C21H16BrClN2O3/c22-18-6-2-1-5-17(18)20(26)25-19(12-14-7-9-15(23)10-8-14)21(27)24-13-16-4-3-11-28-16/h1-12H,13H2,(H,24,27)(H,25,26) |
| InChIKey | JWHZZCUREVZUIU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|