C23H15BrClN2O4- — CID 2247828
4-[[(E)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]benzoate (PubChem CID 2247828) has the molecular formula C23H15BrClN2O4- and a molecular weight of 498.74 g/mol. Its IUPAC name is 4-[[(E)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | 4-[[(E)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2247828 |
| Molecular Formula | C23H15BrClN2O4- |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 496.99 |
| IUPAC Name | 4-[[(E)-2-[(2-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]benzoate |
| SMILES | O=C(Nc1ccc(C(=O)[O-])cc1)/C(=C\c1ccc(Cl)cc1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C23H16BrClN2O4/c24-19-4-2-1-3-18(19)21(28)27-20(13-14-5-9-16(25)10-6-14)22(29)26-17-11-7-15(8-12-17)23(30)31/h1-13H,(H,26,29)(H,27,28)(H,30,31)/p-1/b20-13+ |
| InChIKey | XZNNBZZZQKJFSU-DEDYPNTBSA-M |
| XLogP | 3.88 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|