C23H19N3O7 — CID 2267738
(2S)-2-[[(Z)-2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid (PubChem CID 2267738) has the molecular formula C23H19N3O7 and a molecular weight of 449.42 g/mol. Its IUPAC name is (2S)-2-[[(Z)-2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(Z)-2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 2267738 |
| Molecular Formula | C23H19N3O7 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (2S)-2-[[(Z)-2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)/C(=C/c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C23H19N3O7/c27-21(25-19(23(29)30)14-15-5-2-1-3-6-15)18(24-22(28)20-7-4-12-33-20)13-16-8-10-17(11-9-16)26(31)32/h1-13,19H,14H2,(H,24,28)(H,25,27)(H,29,30)/b18-13-/t19-/m0/s1 |
| InChIKey | MFISJHWYBFLQDK-LJLZWOEMSA-N |
| XLogP | 2.77 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|